C18H11F2NO2S — CID 53472537
9-(3,4-difluorophenyl)-8-methoxy-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 53472537) has the molecular formula C18H11F2NO2S and a molecular weight of 343.35 g/mol. Its IUPAC name is 9-(3,4-difluorophenyl)-8-methoxy-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 9-(3,4-difluorophenyl)-8-methoxy-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 53472537 |
| Molecular Formula | C18H11F2NO2S |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 9-(3,4-difluorophenyl)-8-methoxy-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | COc1ccc2[nH]c(=O)c3sccc3c2c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H11F2NO2S/c1-23-14-5-4-13-16(10-6-7-24-17(10)18(22)21-13)15(14)9-2-3-11(19)12(20)8-9/h2-8H,1H3,(H,21,22) |
| InChIKey | TUYAMPOPPVMZOB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |