C15H20N2O4 — CID 53474524
tert-butyl 2-(3-methoxy-2-oxo-1,4-dihydroquinazolin-4-yl)acetate (PubChem CID 53474524) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is tert-butyl 2-(3-methoxy-2-oxo-1,4-dihydroquinazolin-4-yl)acetate.
| Compound Name | tert-butyl 2-(3-methoxy-2-oxo-1,4-dihydroquinazolin-4-yl)acetate |
|---|---|
| PubChem CID | 53474524 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | tert-butyl 2-(3-methoxy-2-oxo-1,4-dihydroquinazolin-4-yl)acetate |
| SMILES | CON1C(=O)Nc2ccccc2C1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20N2O4/c1-15(2,3)21-13(18)9-12-10-7-5-6-8-11(10)16-14(19)17(12)20-4/h5-8,12H,9H2,1-4H3,(H,16,19) |
| InChIKey | IIHWXARHNCLTCC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |