C25H24F2N2O4 — CID 53476272
1-cyclopropyl-8-(difluoromethoxy)-7-[(3S,4S)-3,4-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 53476272) has the molecular formula C25H24F2N2O4 and a molecular weight of 454.47 g/mol. Its IUPAC name is 1-cyclopropyl-8-(difluoromethoxy)-7-[(3S,4S)-3,4-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-8-(difluoromethoxy)-7-[(3S,4S)-3,4-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 53476272 |
| Molecular Formula | C25H24F2N2O4 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-cyclopropyl-8-(difluoromethoxy)-7-[(3S,4S)-3,4-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | C[C@@H]1NCc2cc(-c3ccc4c(=O)c(C(=O)O)cn(C5CC5)c4c3OC(F)F)ccc2[C@@H]1C |
| InChI | InChI=1S/C25H24F2N2O4/c1-12-13(2)28-10-15-9-14(3-6-17(12)15)18-7-8-19-21(23(18)33-25(26)27)29(16-4-5-16)11-20(22(19)30)24(31)32/h3,6-9,11-13,16,25,28H,4-5,10H2,1-2H3,(H,31,32)/t12-,13+/m1/s1 |
| InChIKey | QNFQVFFAZLFSBV-OLZOCXBDSA-N |
| XLogP | 4.90 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |