C42H33F2N2O4- — CID 19358317
1-cyclopropyl-8-(difluoromethoxy)-7-(1-methyl-2-trityl-1,3-dihydroisoindol-5-yl)-4-oxoquinoline-3-carboxylate (PubChem CID 19358317) has the molecular formula C42H33F2N2O4- and a molecular weight of 667.73 g/mol. Its IUPAC name is 1-cyclopropyl-8-(difluoromethoxy)-7-(1-methyl-2-trityl-1,3-dihydroisoindol-5-yl)-4-oxoquinoline-3-carboxylate.
| Compound Name | 1-cyclopropyl-8-(difluoromethoxy)-7-(1-methyl-2-trityl-1,3-dihydroisoindol-5-yl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 19358317 |
| Molecular Formula | C42H33F2N2O4- |
| Molecular Weight | 667.73 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | 1-cyclopropyl-8-(difluoromethoxy)-7-(1-methyl-2-trityl-1,3-dihydroisoindol-5-yl)-4-oxoquinoline-3-carboxylate |
| SMILES | CC1c2ccc(-c3ccc4c(=O)c(C(=O)[O-])cn(C5CC5)c4c3OC(F)F)cc2CN1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H34F2N2O4/c1-26-33-20-17-27(34-21-22-35-37(39(34)50-41(43)44)45(32-18-19-32)25-36(38(35)47)40(48)49)23-28(33)24-46(26)42(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-17,20-23,25-26,32,41H,18-19,24H2,1H3,(H,48,49)/p-1 |
| InChIKey | ZUKGCKVIKBIABW-UHFFFAOYSA-M |
| XLogP | 7.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.73 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|