C16H17NO9 — CID 53481609
4-oxo-8-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-quinoline-2-carboxylic acid (PubChem CID 53481609) has the molecular formula C16H17NO9 and a molecular weight of 367.31 g/mol. Its IUPAC name is 4-oxo-8-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-quinoline-2-carboxylic acid.
| Compound Name | 4-oxo-8-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 53481609 |
| Molecular Formula | C16H17NO9 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-oxo-8-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2cccc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@@H]3O)c2[nH]1 |
| InChI | InChI=1S/C16H17NO9/c18-5-10-12(20)13(21)14(22)16(26-10)25-9-3-1-2-6-8(19)4-7(15(23)24)17-11(6)9/h1-4,10,12-14,16,18,20-22H,5H2,(H,17,19)(H,23,24)/t10-,12+,13+,14+,16-/m1/s1 |
| InChIKey | MYFHOUJDPFBJLH-XGJKELJWSA-N |
| XLogP | -1.60 |
| TPSA | 169.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |