C20H16O2 — CID 53483298
methyl (2Z)-2-(5,6-dihydrobenzo[a]fluoren-11-ylidene)acetate (PubChem CID 53483298) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl (2Z)-2-(5,6-dihydrobenzo[a]fluoren-11-ylidene)acetate.
| Compound Name | methyl (2Z)-2-(5,6-dihydrobenzo[a]fluoren-11-ylidene)acetate |
|---|---|
| PubChem CID | 53483298 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl (2Z)-2-(5,6-dihydrobenzo[a]fluoren-11-ylidene)acetate |
| SMILES | COC(=O)/C=C1\C2=C(CCc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C20H16O2/c1-22-19(21)12-18-16-9-5-4-8-15(16)17-11-10-13-6-2-3-7-14(13)20(17)18/h2-9,12H,10-11H2,1H3/b18-12- |
| InChIKey | GNPCEMNURXNEGR-PDGQHHTCSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|