C17H13ClN6O2 — CID 53483488
ethyl (Z)-3-[[1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-cyanoprop-2-enoate (PubChem CID 53483488) has the molecular formula C17H13ClN6O2 and a molecular weight of 368.78 g/mol. Its IUPAC name is ethyl (Z)-3-[[1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (Z)-3-[[1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 53483488 |
| Molecular Formula | C17H13ClN6O2 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | ethyl (Z)-3-[[1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\Nc1ncnc2c1cnn2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN6O2/c1-2-26-17(25)11(7-19)8-20-15-14-9-23-24(16(14)22-10-21-15)13-5-3-12(18)4-6-13/h3-6,8-10H,2H2,1H3,(H,20,21,22)/b11-8- |
| InChIKey | AKMBJAAVMKKKAD-FLIBITNWSA-N |
| XLogP | 2.85 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|