C8H11F2NO — CID 53484589
N-(2,2-difluoroethyl)-3-methylidenecyclobutane-1-carboxamide (PubChem CID 53484589) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-methylidenecyclobutane-1-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-3-methylidenecyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 53484589 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-methylidenecyclobutane-1-carboxamide |
| SMILES | C=C1CC(C(=O)NCC(F)F)C1 |
| InChI | InChI=1S/C8H11F2NO/c1-5-2-6(3-5)8(12)11-4-7(9)10/h6-7H,1-4H2,(H,11,12) |
| InChIKey | SFBJRITXTLDBPI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|