C17H22ClN5O3S — CID 53490574
5-(3-chloro-4-methoxyphenyl)sulfonyl-2-(4-ethylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 53490574) has the molecular formula C17H22ClN5O3S and a molecular weight of 411.92 g/mol. Its IUPAC name is 5-(3-chloro-4-methoxyphenyl)sulfonyl-2-(4-ethylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 5-(3-chloro-4-methoxyphenyl)sulfonyl-2-(4-ethylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 53490574 |
| Molecular Formula | C17H22ClN5O3S |
| Molecular Weight | 411.92 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 5-(3-chloro-4-methoxyphenyl)sulfonyl-2-(4-ethylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CCN1CCN(c2ncc(S(=O)(=O)c3ccc(OC)c(Cl)c3)c(N)n2)CC1 |
| InChI | InChI=1S/C17H22ClN5O3S/c1-3-22-6-8-23(9-7-22)17-20-11-15(16(19)21-17)27(24,25)12-4-5-14(26-2)13(18)10-12/h4-5,10-11H,3,6-9H2,1-2H3,(H2,19,20,21) |
| InChIKey | KEZIEYDSUARWIE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.92 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |