C21H29N5O4S — CID 53490630
ethyl 2-[4-[4-amino-5-(4-propan-2-ylphenyl)sulfonylpyrimidin-2-yl]piperazin-1-yl]acetate (PubChem CID 53490630) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is ethyl 2-[4-[4-amino-5-(4-propan-2-ylphenyl)sulfonylpyrimidin-2-yl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[4-amino-5-(4-propan-2-ylphenyl)sulfonylpyrimidin-2-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 53490630 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | ethyl 2-[4-[4-amino-5-(4-propan-2-ylphenyl)sulfonylpyrimidin-2-yl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(c2ncc(S(=O)(=O)c3ccc(C(C)C)cc3)c(N)n2)CC1 |
| InChI | InChI=1S/C21H29N5O4S/c1-4-30-19(27)14-25-9-11-26(12-10-25)21-23-13-18(20(22)24-21)31(28,29)17-7-5-16(6-8-17)15(2)3/h5-8,13,15H,4,9-12,14H2,1-3H3,(H2,22,23,24) |
| InChIKey | OWYCMCGIBSEMHI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |