C21H22FN5O2S — CID 53490643
2-[4-(4-fluorophenyl)piperazin-1-yl]-5-(4-methylphenyl)sulfonylpyrimidin-4-amine (PubChem CID 53490643) has the molecular formula C21H22FN5O2S and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-yl]-5-(4-methylphenyl)sulfonylpyrimidin-4-amine.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-5-(4-methylphenyl)sulfonylpyrimidin-4-amine |
|---|---|
| PubChem CID | 53490643 |
| Molecular Formula | C21H22FN5O2S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-5-(4-methylphenyl)sulfonylpyrimidin-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2cnc(N3CCN(c4ccc(F)cc4)CC3)nc2N)cc1 |
| InChI | InChI=1S/C21H22FN5O2S/c1-15-2-8-18(9-3-15)30(28,29)19-14-24-21(25-20(19)23)27-12-10-26(11-13-27)17-6-4-16(22)5-7-17/h2-9,14H,10-13H2,1H3,(H2,23,24,25) |
| InChIKey | YTKKMRNUUCSVOI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |