About 2-methylhepta-1,6-diene
2-methylhepta-1,6-diene (PubChem CID 534918) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol. Its IUPAC name is 2-methylhepta-1,6-diene.
Molecular Properties
| Compound Name | 2-methylhepta-1,6-diene |
| PubChem CID | 534918 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | 2-methylhepta-1,6-diene |
| SMILES | C=CCCCC(=C)C |
| InChI | InChI=1S/C8H14/c1-4-5-6-7-8(2)3/h4H,1-2,5-7H2,3H3 |
| InChIKey | XNUNYHQZMMREQD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhepta-1,6-diene?
The IUPAC name of 2-methylhepta-1,6-diene (CID 534918) is 2-methylhepta-1,6-diene.
What is the SMILES notation for 2-methylhepta-1,6-diene?
The canonical SMILES for 2-methylhepta-1,6-diene is C=CCCCC(=C)C.
What is the InChIKey of 2-methylhepta-1,6-diene?
The InChIKey is XNUNYHQZMMREQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14/c1-4-5-6-7-8(2)3/h4H,1-2,5-7H2,3H3.
What are the key properties of 2-methylhepta-1,6-diene?
2-methylhepta-1,6-diene has a molecular weight of 110.20 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhepta-1,6-diene is sourced from PubChem (CID 534918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).