C25H19Cl2N9O4 — CID 53492622
N-[4-chloro-2-methyl-6-(methylcarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-[(5-nitrobenzotriazol-2-yl)methyl]pyrazole-5-carboxamide (PubChem CID 53492622) has the molecular formula C25H19Cl2N9O4 and a molecular weight of 580.39 g/mol. Its IUPAC name is N-[4-chloro-2-methyl-6-(methylcarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-[(5-nitrobenzotriazol-2-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | N-[4-chloro-2-methyl-6-(methylcarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-[(5-nitrobenzotriazol-2-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 53492622 |
| Molecular Formula | C25H19Cl2N9O4 |
| Molecular Weight | 580.39 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | N-[4-chloro-2-methyl-6-(methylcarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-[(5-nitrobenzotriazol-2-yl)methyl]pyrazole-5-carboxamide |
| SMILES | CNC(=O)c1cc(Cl)cc(C)c1NC(=O)c1cc(Cn2nc3ccc([N+](=O)[O-])cc3n2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C25H19Cl2N9O4/c1-13-8-14(26)9-17(24(37)28-2)22(13)30-25(38)21-10-15(31-35(21)23-18(27)4-3-7-29-23)12-34-32-19-6-5-16(36(39)40)11-20(19)33-34/h3-11H,12H2,1-2H3,(H,28,37)(H,30,38) |
| InChIKey | JOLLZWJAROIUPD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|