C14H9Cl3N2O2 — CID 5349309
[(Z)-[amino-(4-chlorophenyl)methylidene]amino] 2,4-dichlorobenzoate (PubChem CID 5349309) has the molecular formula C14H9Cl3N2O2 and a molecular weight of 343.60 g/mol. Its IUPAC name is [(Z)-[amino-(4-chlorophenyl)methylidene]amino] 2,4-dichlorobenzoate.
| Compound Name | [(Z)-[amino-(4-chlorophenyl)methylidene]amino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 5349309 |
| Molecular Formula | C14H9Cl3N2O2 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | [(Z)-[amino-(4-chlorophenyl)methylidene]amino] 2,4-dichlorobenzoate |
| SMILES | N/C(=N\OC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9Cl3N2O2/c15-9-3-1-8(2-4-9)13(18)19-21-14(20)11-6-5-10(16)7-12(11)17/h1-7H,(H2,18,19) |
| InChIKey | ONMJCLPUHLOIPE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|