C10H6F3N5O — CID 53493105
N-pyridazin-4-yl-2-(trifluoromethyl)pyrimidine-4-carboxamide (PubChem CID 53493105) has the molecular formula C10H6F3N5O and a molecular weight of 269.19 g/mol. Its IUPAC name is N-pyridazin-4-yl-2-(trifluoromethyl)pyrimidine-4-carboxamide.
| Compound Name | N-pyridazin-4-yl-2-(trifluoromethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 53493105 |
| Molecular Formula | C10H6F3N5O |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-pyridazin-4-yl-2-(trifluoromethyl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccnnc1)c1ccnc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H6F3N5O/c11-10(12,13)9-14-3-2-7(18-9)8(19)17-6-1-4-15-16-5-6/h1-5H,(H,15,17,19) |
| InChIKey | BFYPOUCSXZPMNV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |