C17H14N2O3S — CID 53493229
1,1-dioxo-4-[5-(2-phenylethynyl)-2-pyridinyl]-1,4-thiazinan-3-one (PubChem CID 53493229) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is 1,1-dioxo-4-[5-(2-phenylethynyl)-2-pyridinyl]-1,4-thiazinan-3-one.
| Compound Name | 1,1-dioxo-4-[5-(2-phenylethynyl)-2-pyridinyl]-1,4-thiazinan-3-one |
|---|---|
| PubChem CID | 53493229 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1,1-dioxo-4-[5-(2-phenylethynyl)-2-pyridinyl]-1,4-thiazinan-3-one |
| SMILES | O=C1CS(=O)(=O)CCN1c1ccc(C#Cc2ccccc2)cn1 |
| InChI | InChI=1S/C17H14N2O3S/c20-17-13-23(21,22)11-10-19(17)16-9-8-15(12-18-16)7-6-14-4-2-1-3-5-14/h1-5,8-9,12H,10-11,13H2 |
| InChIKey | CEGIJZFEIDUTNC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|