C21H20N2O2 — CID 53493358
3-[5-(2-phenylethynyl)-2-pyridinyl]-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 53493358) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[5-(2-phenylethynyl)-2-pyridinyl]-1-oxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | 3-[5-(2-phenylethynyl)-2-pyridinyl]-1-oxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 53493358 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-[5-(2-phenylethynyl)-2-pyridinyl]-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | O=C1OC2(CCCCC2)CN1c1ccc(C#Cc2ccccc2)cn1 |
| InChI | InChI=1S/C21H20N2O2/c24-20-23(16-21(25-20)13-5-2-6-14-21)19-12-11-18(15-22-19)10-9-17-7-3-1-4-8-17/h1,3-4,7-8,11-12,15H,2,5-6,13-14,16H2 |
| InChIKey | OZKBWEDVSNOMJW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|