C10H14N4S — CID 53493435
(6-butan-2-ylthieno[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 53493435) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is (6-butan-2-ylthieno[2,3-d]pyrimidin-4-yl)hydrazine.
| Compound Name | (6-butan-2-ylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 53493435 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (6-butan-2-ylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | CCC(C)c1cc2c(NN)ncnc2s1 |
| InChI | InChI=1S/C10H14N4S/c1-3-6(2)8-4-7-9(14-11)12-5-13-10(7)15-8/h4-6H,3,11H2,1-2H3,(H,12,13,14) |
| InChIKey | MQFFDQUXCCCEJD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|