C17H16ClNO3S — CID 53493594
(3S,4R)-4-benzyl-1-(4-chlorophenyl)-3-methylsulfonylazetidin-2-one (PubChem CID 53493594) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is (3S,4R)-4-benzyl-1-(4-chlorophenyl)-3-methylsulfonylazetidin-2-one.
| Compound Name | (3S,4R)-4-benzyl-1-(4-chlorophenyl)-3-methylsulfonylazetidin-2-one |
|---|---|
| PubChem CID | 53493594 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | (3S,4R)-4-benzyl-1-(4-chlorophenyl)-3-methylsulfonylazetidin-2-one |
| SMILES | CS(=O)(=O)[C@@H]1C(=O)N(c2ccc(Cl)cc2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H16ClNO3S/c1-23(21,22)16-15(11-12-5-3-2-4-6-12)19(17(16)20)14-9-7-13(18)8-10-14/h2-10,15-16H,11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | MXELWUPYTIMCER-CVEARBPZSA-N |
| XLogP | 2.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |