C34H57N3O — CID 53493976
[(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-amino-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]-piperazin-1-ylmethanone (PubChem CID 53493976) has the molecular formula C34H57N3O and a molecular weight of 523.85 g/mol. Its IUPAC name is [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-amino-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]-piperazin-1-ylmethanone.
| Compound Name | [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-amino-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 53493976 |
| Molecular Formula | C34H57N3O |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.45 |
| IUPAC Name | [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-amino-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]-piperazin-1-ylmethanone |
| SMILES | CC1(C)CC[C@]2(C(=O)N3CCNCC3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](N)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C34H57N3O/c1-29(2)14-16-34(28(38)37-20-18-36-19-21-37)17-15-32(6)23(24(34)22-29)8-9-26-31(5)12-11-27(35)30(3,4)25(31)10-13-33(26,32)7/h8,24-27,36H,9-22,35H2,1-7H3/t24-,25-,26+,27-,31-,32+,33+,34-/m0/s1 |
| InChIKey | BTKYJOIUYJYBIM-AVVVTVBRSA-N |
| XLogP | 6.55 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|