C30H44N2O6 — CID 53496356
methyl 2-[(1S,3aS,4S,8aS)-3a,8a-dimethyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-(phenylmethoxycarbonylamino)-1,2,3,4,5,8-hexahydroazulen-6-yl]propanoate (PubChem CID 53496356) has the molecular formula C30H44N2O6 and a molecular weight of 528.69 g/mol. Its IUPAC name is methyl 2-[(1S,3aS,4S,8aS)-3a,8a-dimethyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-(phenylmethoxycarbonylamino)-1,2,3,4,5,8-hexahydroazulen-6-yl]propanoate.
| Compound Name | methyl 2-[(1S,3aS,4S,8aS)-3a,8a-dimethyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-(phenylmethoxycarbonylamino)-1,2,3,4,5,8-hexahydroazulen-6-yl]propanoate |
|---|---|
| PubChem CID | 53496356 |
| Molecular Formula | C30H44N2O6 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | methyl 2-[(1S,3aS,4S,8aS)-3a,8a-dimethyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-(phenylmethoxycarbonylamino)-1,2,3,4,5,8-hexahydroazulen-6-yl]propanoate |
| SMILES | COC(=O)C(C)C1=CC[C@]2(C)[C@@H](NC(=O)OCc3ccccc3)CC[C@]2(C)[C@@H](N(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C30H44N2O6/c1-20(25(33)36-8)22-14-16-29(5)23(31-26(34)37-19-21-12-10-9-11-13-21)15-17-30(29,6)24(18-22)32(7)27(35)38-28(2,3)4/h9-14,20,23-24H,15-19H2,1-8H3,(H,31,34)/t20?,23-,24-,29+,30+/m0/s1 |
| InChIKey | ZMYLNGIQCMKXSV-XZKOOOMPSA-N |
| XLogP | 5.85 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|