C14H18ClNO5S — CID 534992
methyl 4-[(3-chloro-2-ethylsulfonyl-2-methylpropanoyl)amino]benzoate (PubChem CID 534992) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is methyl 4-[(3-chloro-2-ethylsulfonyl-2-methylpropanoyl)amino]benzoate.
| Compound Name | methyl 4-[(3-chloro-2-ethylsulfonyl-2-methylpropanoyl)amino]benzoate |
|---|---|
| PubChem CID | 534992 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | methyl 4-[(3-chloro-2-ethylsulfonyl-2-methylpropanoyl)amino]benzoate |
| SMILES | CCS(=O)(=O)C(C)(CCl)C(=O)Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C14H18ClNO5S/c1-4-22(19,20)14(2,9-15)13(18)16-11-7-5-10(6-8-11)12(17)21-3/h5-8H,4,9H2,1-3H3,(H,16,18) |
| InChIKey | BNFVVQFQKLDZCV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|