C15H20N2O5S — CID 4234809
methyl 4-[(1-methylsulfonylpiperidine-3-carbonyl)amino]benzoate (PubChem CID 4234809) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is methyl 4-[(1-methylsulfonylpiperidine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(1-methylsulfonylpiperidine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 4234809 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | methyl 4-[(1-methylsulfonylpiperidine-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCCN(S(C)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C15H20N2O5S/c1-22-15(19)11-5-7-13(8-6-11)16-14(18)12-4-3-9-17(10-12)23(2,20)21/h5-8,12H,3-4,9-10H2,1-2H3,(H,16,18) |
| InChIKey | VWFROOXODCBUMF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |