C16H25N5O2 — CID 53499400
1-N-[6-(diethylamino)-3-pyridinyl]piperidine-1,4-dicarboxamide (PubChem CID 53499400) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-N-[6-(diethylamino)-3-pyridinyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[6-(diethylamino)-3-pyridinyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 53499400 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 1-N-[6-(diethylamino)-3-pyridinyl]piperidine-1,4-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)N2CCC(C(N)=O)CC2)cn1 |
| InChI | InChI=1S/C16H25N5O2/c1-3-20(4-2)14-6-5-13(11-18-14)19-16(23)21-9-7-12(8-10-21)15(17)22/h5-6,11-12H,3-4,7-10H2,1-2H3,(H2,17,22)(H,19,23) |
| InChIKey | BJBYFEONELOPGI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |