C19H29N5O3 — CID 94168440
N-[6-(diethylamino)-3-pyridinyl]-4-[(2R)-oxolane-2-carbonyl]piperazine-1-carboxamide (PubChem CID 94168440) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[6-(diethylamino)-3-pyridinyl]-4-[(2R)-oxolane-2-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-[6-(diethylamino)-3-pyridinyl]-4-[(2R)-oxolane-2-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 94168440 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[6-(diethylamino)-3-pyridinyl]-4-[(2R)-oxolane-2-carbonyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)N2CCN(C(=O)[C@H]3CCCO3)CC2)cn1 |
| InChI | InChI=1S/C19H29N5O3/c1-3-22(4-2)17-8-7-15(14-20-17)21-19(26)24-11-9-23(10-12-24)18(25)16-6-5-13-27-16/h7-8,14,16H,3-6,9-13H2,1-2H3,(H,21,26)/t16-/m1/s1 |
| InChIKey | UKEZSJRILVIYFW-MRXNPFEDSA-N |
| XLogP | 1.78 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |