C23H14FN3O4S — CID 5350780
(2Z)-2-[[2-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 5350780) has the molecular formula C23H14FN3O4S and a molecular weight of 447.45 g/mol. Its IUPAC name is (2Z)-2-[[2-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2Z)-2-[[2-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 5350780 |
| Molecular Formula | C23H14FN3O4S |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | (2Z)-2-[[2-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | O=c1/c(=C/c2cc([N+](=O)[O-])ccc2OCc2ccccc2F)sc2nc3ccccc3n12 |
| InChI | InChI=1S/C23H14FN3O4S/c24-17-6-2-1-5-14(17)13-31-20-10-9-16(27(29)30)11-15(20)12-21-22(28)26-19-8-4-3-7-18(19)25-23(26)32-21/h1-12H,13H2/b21-12- |
| InChIKey | PERFJDOKROCXLS-MTJSOVHGSA-N |
| XLogP | 4.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|