About 4-Methyl-2-hexene
4-Methyl-2-hexene (PubChem CID 5357249) has the molecular formula C7H14
and a molecular weight of 98.19 g/mol. Its IUPAC name is (E)-4-methylhex-2-ene.
Molecular Properties
| Compound Name | 4-Methyl-2-hexene |
| PubChem CID | 5357249 |
| Molecular Formula | C7H14 |
| Molecular Weight | 98.19 g/mol |
| Exact Mass | 98.11 |
| IUPAC Name | (E)-4-methylhex-2-ene |
| SMILES | CCC(C)/C=C/C |
| InChI | InChI=1S/C7H14/c1-4-6-7(3)5-2/h4,6-7H,5H2,1-3H3/b6-4+ |
| InChIKey | MBNDKEPQUVZHCM-GQCTYLIASA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | 53 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-Methyl-2-hexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Methyl-2-hexene?
The IUPAC name of 4-Methyl-2-hexene (CID 5357249) is (E)-4-methylhex-2-ene.
What is the SMILES notation for 4-Methyl-2-hexene?
The canonical SMILES for 4-Methyl-2-hexene is CCC(C)/C=C/C.
What is the InChIKey of 4-Methyl-2-hexene?
The InChIKey is MBNDKEPQUVZHCM-GQCTYLIASA-N. The full InChI is InChI=1S/C7H14/c1-4-6-7(3)5-2/h4,6-7H,5H2,1-3H3/b6-4+.
What are the key properties of 4-Methyl-2-hexene?
4-Methyl-2-hexene has a molecular weight of 98.19 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Methyl-2-hexene is sourced from PubChem (CID 5357249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).