About copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate)
copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate) (PubChem CID 5363727) has the molecular formula C14H20CuO8
and a molecular weight of 379.85 g/mol. Its IUPAC name is copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate).
Molecular Properties
| Compound Name | copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate) |
| PubChem CID | 5363727 |
| Molecular Formula | C14H20CuO8 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate) |
| SMILES | CC(=O)O/C(C(C)=O)=C(\C)O.CC(=O)O/C(C(C)=O)=C(\C)O.[Cu] |
| InChI | InChI=1S/2C7H10O4.Cu/c2*1-4(8)7(5(2)9)11-6(3)10;/h2*8H,1-3H3;/b2*7-4+; |
| InChIKey | SBFQRZDUKORJOI-ISBQNHGHSA-N |
| XLogP | 1.85 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate)?
The IUPAC name of copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate) (CID 5363727) is copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate).
What is the SMILES notation for copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate)?
The canonical SMILES for copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate) is CC(=O)O/C(C(C)=O)=C(\C)O.CC(=O)O/C(C(C)=O)=C(\C)O.[Cu].
What is the InChIKey of copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate)?
The InChIKey is SBFQRZDUKORJOI-ISBQNHGHSA-N. The full InChI is InChI=1S/2C7H10O4.Cu/c2*1-4(8)7(5(2)9)11-6(3)10;/h2*8H,1-3H3;/b2*7-4+;.
What are the key properties of copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate)?
copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate) has a molecular weight of 379.85 g/mol, XLogP of 1.85, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis([(E)-2-hydroxy-4-oxopent-2-en-3-yl] acetate) is sourced from PubChem (CID 5363727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).