About azane;carboxy acetate;copper
azane;carboxy acetate;copper (PubChem CID 175513331) has the molecular formula C3H7CuNO4
and a molecular weight of 184.64 g/mol. Its IUPAC name is azane;carboxy acetate;copper.
Molecular Properties
| Compound Name | azane;carboxy acetate;copper |
| PubChem CID | 175513331 |
| Molecular Formula | C3H7CuNO4 |
| Molecular Weight | 184.64 g/mol |
| Exact Mass | 183.97 |
| IUPAC Name | azane;carboxy acetate;copper |
| SMILES | CC(=O)OC(=O)O.N.[Cu] |
| InChI | InChI=1S/C3H4O4.Cu.H3N/c1-2(4)7-3(5)6;;/h1H3,(H,5,6);;1H3 |
| InChIKey | IKXQDEBWZOCTPB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.64 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;carboxy acetate;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carboxy acetate;copper?
The IUPAC name of azane;carboxy acetate;copper (CID 175513331) is azane;carboxy acetate;copper.
What is the SMILES notation for azane;carboxy acetate;copper?
The canonical SMILES for azane;carboxy acetate;copper is CC(=O)OC(=O)O.N.[Cu].
What is the InChIKey of azane;carboxy acetate;copper?
The InChIKey is IKXQDEBWZOCTPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O4.Cu.H3N/c1-2(4)7-3(5)6;;/h1H3,(H,5,6);;1H3.
What are the key properties of azane;carboxy acetate;copper?
azane;carboxy acetate;copper has a molecular weight of 184.64 g/mol, XLogP of 0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carboxy acetate;copper is sourced from PubChem (CID 175513331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).