About azane;sulfanyl acetate
azane;sulfanyl acetate (PubChem CID 174466207) has the molecular formula C2H7NO2S
and a molecular weight of 109.15 g/mol. Its IUPAC name is azane;sulfanyl acetate.
Molecular Properties
| Compound Name | azane;sulfanyl acetate |
| PubChem CID | 174466207 |
| Molecular Formula | C2H7NO2S |
| Molecular Weight | 109.15 g/mol |
| Exact Mass | 109.02 |
| IUPAC Name | azane;sulfanyl acetate |
| SMILES | CC(=O)OS.N |
| InChI | InChI=1S/C2H4O2S.H3N/c1-2(3)4-5;/h5H,1H3;1H3 |
| InChIKey | ZUXCNAWFEKFFIX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;sulfanyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;sulfanyl acetate?
The IUPAC name of azane;sulfanyl acetate (CID 174466207) is azane;sulfanyl acetate.
What is the SMILES notation for azane;sulfanyl acetate?
The canonical SMILES for azane;sulfanyl acetate is CC(=O)OS.N.
What is the InChIKey of azane;sulfanyl acetate?
The InChIKey is ZUXCNAWFEKFFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2S.H3N/c1-2(3)4-5;/h5H,1H3;1H3.
What are the key properties of azane;sulfanyl acetate?
azane;sulfanyl acetate has a molecular weight of 109.15 g/mol, XLogP of 0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;sulfanyl acetate is sourced from PubChem (CID 174466207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).