About Aluminumacetate
Aluminumacetate (PubChem CID 16683978) has the molecular formula C2H7AlO4
and a molecular weight of 122.06 g/mol.
Molecular Properties
| Compound Name | Aluminumacetate |
| PubChem CID | 16683978 |
| Molecular Formula | C2H7AlO4 |
| Molecular Weight | 122.06 g/mol |
| Exact Mass | 122.02 |
| IUPAC Name | — |
| SMILES | CC(=O)O[Al].O.O |
| InChI | InChI=1S/C2H4O2.Al.2H2O/c1-2(3)4;;;/h1H3,(H,3,4);;2*1H2/q;+1;;/p-1 |
| InChIKey | HDYRYUINDGQKMC-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 89.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.06 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Aluminumacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Aluminumacetate?
The IUPAC name of Aluminumacetate (CID 16683978) is not available.
What is the SMILES notation for Aluminumacetate?
The canonical SMILES for Aluminumacetate is CC(=O)O[Al].O.O.
What is the InChIKey of Aluminumacetate?
The InChIKey is HDYRYUINDGQKMC-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Al.2H2O/c1-2(3)4;;;/h1H3,(H,3,4);;2*1H2/q;+1;;/p-1.
What are the key properties of Aluminumacetate?
Aluminumacetate has a molecular weight of 122.06 g/mol, XLogP of -2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Aluminumacetate is sourced from PubChem (CID 16683978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).