About CID 162323307
CID 162323307 (PubChem CID 162323307) has the molecular formula C2H6O3S2
and a molecular weight of 142.20 g/mol.
Molecular Properties
| Compound Name | CID 162323307 |
| PubChem CID | 162323307 |
| Molecular Formula | C2H6O3S2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 141.98 |
| IUPAC Name | — |
| SMILES | CC(=O)O.SOS |
| InChI | InChI=1S/C2H4O2.H2OS2/c1-2(3)4;2-1-3/h1H3,(H,3,4);2-3H |
| InChIKey | HUGOGZMJMUFUBH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 162323307 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162323307?
The IUPAC name of CID 162323307 (CID 162323307) is not available.
What is the SMILES notation for CID 162323307?
The canonical SMILES for CID 162323307 is CC(=O)O.SOS.
What is the InChIKey of CID 162323307?
The InChIKey is HUGOGZMJMUFUBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.H2OS2/c1-2(3)4;2-1-3/h1H3,(H,3,4);2-3H.
What are the key properties of CID 162323307?
CID 162323307 has a molecular weight of 142.20 g/mol, XLogP of 0.78, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162323307 is sourced from PubChem (CID 162323307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).