C18H28O8 — CID 5363826
methyl (E)-4-[7-(2-acetyloxyethyl)-7-hydroxy-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate (PubChem CID 5363826) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is methyl (E)-4-[7-(2-acetyloxyethyl)-7-hydroxy-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-[7-(2-acetyloxyethyl)-7-hydroxy-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 5363826 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | methyl (E)-4-[7-(2-acetyloxyethyl)-7-hydroxy-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)/C=C(\C)CC1OCC(O)(CCOC(C)=O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C18H28O8/c1-11(9-14(20)22-5)8-13-15-16(26-17(3,4)25-15)18(21,10-24-13)6-7-23-12(2)19/h9,13,15-16,21H,6-8,10H2,1-5H3/b11-9+ |
| InChIKey | OKNQLBJUERVUNO-PKNBQFBNSA-N |
| XLogP | 1.10 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|