About 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane
5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane (PubChem CID 536590) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane.
Analyze 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane?
The IUPAC name of 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane (CID 536590) is 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane.
What is the SMILES notation for 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane?
The canonical SMILES for 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane is CC12CSCC(CO1)O2.
What is the InChIKey of 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane?
The InChIKey is BCVJPJHOCWXHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-6-4-9-3-5(8-6)2-7-6/h5H,2-4H2,1H3.
What are the key properties of 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane?
5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane has a molecular weight of 146.21 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane is sourced from PubChem (CID 536590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).