C5H8O2S — CID 534531
6,8-dioxa-3-thiabicyclo[3.2.1]octane (PubChem CID 534531) has the molecular formula C5H8O2S and a molecular weight of 132.18 g/mol. Its IUPAC name is 6,8-dioxa-3-thiabicyclo[3.2.1]octane.
| Compound Name | 6,8-dioxa-3-thiabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 534531 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 6,8-dioxa-3-thiabicyclo[3.2.1]octane |
| SMILES | C1OC2CSCC1O2 |
| InChI | InChI=1S/C5H8O2S/c1-4-2-8-3-5(6-1)7-4/h4-5H,1-3H2 |
| InChIKey | UUONPLRQJYEGDF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |