C8H14O2 — CID 5366259
(5E)-2-methylhepta-1,5-diene-3,4-diol (PubChem CID 5366259) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (5E)-2-methylhepta-1,5-diene-3,4-diol.
| Compound Name | (5E)-2-methylhepta-1,5-diene-3,4-diol |
|---|---|
| PubChem CID | 5366259 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (5E)-2-methylhepta-1,5-diene-3,4-diol |
| SMILES | C=C(C)C(O)C(O)/C=C/C |
| InChI | InChI=1S/C8H14O2/c1-4-5-7(9)8(10)6(2)3/h4-5,7-10H,2H2,1,3H3/b5-4+ |
| InChIKey | ILADTYCAGOFDDE-SNAWJCMRSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|