C19H38O6Si3 — CID 5366461
1-O-ethyl 4-O-trimethylsilyl (2E)-2-[(E)-1,3-bis(trimethylsilyloxy)but-2-enylidene]butanedioate (PubChem CID 5366461) has the molecular formula C19H38O6Si3 and a molecular weight of 446.77 g/mol. Its IUPAC name is 1-O-ethyl 4-O-trimethylsilyl (2E)-2-[(E)-1,3-bis(trimethylsilyloxy)but-2-enylidene]butanedioate.
| Compound Name | 1-O-ethyl 4-O-trimethylsilyl (2E)-2-[(E)-1,3-bis(trimethylsilyloxy)but-2-enylidene]butanedioate |
|---|---|
| PubChem CID | 5366461 |
| Molecular Formula | C19H38O6Si3 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-O-ethyl 4-O-trimethylsilyl (2E)-2-[(E)-1,3-bis(trimethylsilyloxy)but-2-enylidene]butanedioate |
| SMILES | CCOC(=O)/C(CC(=O)O[Si](C)(C)C)=C(\C=C(/C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H38O6Si3/c1-12-22-19(21)16(14-18(20)25-28(9,10)11)17(24-27(6,7)8)13-15(2)23-26(3,4)5/h13H,12,14H2,1-11H3/b15-13+,17-16+ |
| InChIKey | NBOMRNALDKAKIF-TZSXFDEBSA-N |
| XLogP | 5.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|