C16H34O4Si3 — CID 5366728
trimethylsilyl (4Z)-4,6-bis(trimethylsilyloxy)hepta-4,6-dienoate (PubChem CID 5366728) has the molecular formula C16H34O4Si3 and a molecular weight of 374.70 g/mol. Its IUPAC name is trimethylsilyl (4Z)-4,6-bis(trimethylsilyloxy)hepta-4,6-dienoate.
| Compound Name | trimethylsilyl (4Z)-4,6-bis(trimethylsilyloxy)hepta-4,6-dienoate |
|---|---|
| PubChem CID | 5366728 |
| Molecular Formula | C16H34O4Si3 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | trimethylsilyl (4Z)-4,6-bis(trimethylsilyloxy)hepta-4,6-dienoate |
| SMILES | C=C(/C=C(/CCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H34O4Si3/c1-14(18-21(2,3)4)13-15(19-22(5,6)7)11-12-16(17)20-23(8,9)10/h13H,1,11-12H2,2-10H3/b15-13- |
| InChIKey | FFVKMUPBHZNWRM-SQFISAMPSA-N |
| XLogP | 5.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|