C24H50O5Si3 — CID 91745424
bis[tert-butyl(dimethyl)silyl] (Z)-3-[tert-butyl(dimethyl)silyl]oxyhex-2-enedioate (PubChem CID 91745424) has the molecular formula C24H50O5Si3 and a molecular weight of 502.92 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] (Z)-3-[tert-butyl(dimethyl)silyl]oxyhex-2-enedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] (Z)-3-[tert-butyl(dimethyl)silyl]oxyhex-2-enedioate |
|---|---|
| PubChem CID | 91745424 |
| Molecular Formula | C24H50O5Si3 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] (Z)-3-[tert-butyl(dimethyl)silyl]oxyhex-2-enedioate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)/C=C(/CCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O5Si3/c1-22(2,3)30(10,11)27-19(18-21(26)29-32(14,15)24(7,8)9)16-17-20(25)28-31(12,13)23(4,5)6/h18H,16-17H2,1-15H3/b19-18- |
| InChIKey | GUPFIUAINOTFTQ-HNENSFHCSA-N |
| XLogP | 7.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|