C24H48O6Si3 — CID 20831117
tris[tert-butyl(dimethyl)silyl] (E)-prop-1-ene-1,2,3-tricarboxylate (PubChem CID 20831117) has the molecular formula C24H48O6Si3 and a molecular weight of 516.90 g/mol. Its IUPAC name is tris[tert-butyl(dimethyl)silyl] (E)-prop-1-ene-1,2,3-tricarboxylate.
| Compound Name | tris[tert-butyl(dimethyl)silyl] (E)-prop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 20831117 |
| Molecular Formula | C24H48O6Si3 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | tris[tert-butyl(dimethyl)silyl] (E)-prop-1-ene-1,2,3-tricarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)/C=C(\CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O6Si3/c1-22(2,3)31(10,11)28-19(25)16-18(21(27)30-33(14,15)24(7,8)9)17-20(26)29-32(12,13)23(4,5)6/h16H,17H2,1-15H3/b18-16+ |
| InChIKey | IHNCVZAILQVPPN-FBMGVBCBSA-N |
| XLogP | 6.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|