C28H24N2 — CID 5368656
(Z)-N-[(E)-1,2-diphenylethylideneamino]-1,2-diphenylethanimine (PubChem CID 5368656) has the molecular formula C28H24N2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (Z)-N-[(E)-1,2-diphenylethylideneamino]-1,2-diphenylethanimine.
| Compound Name | (Z)-N-[(E)-1,2-diphenylethylideneamino]-1,2-diphenylethanimine |
|---|---|
| PubChem CID | 5368656 |
| Molecular Formula | C28H24N2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (Z)-N-[(E)-1,2-diphenylethylideneamino]-1,2-diphenylethanimine |
| SMILES | c1ccc(C/C(=N/N=C(\Cc2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2/c1-5-13-23(14-6-1)21-27(25-17-9-3-10-18-25)29-30-28(26-19-11-4-12-20-26)22-24-15-7-2-8-16-24/h1-20H,21-22H2/b29-27-,30-28+ |
| InChIKey | HWHDZCPTMRTNPT-JOKXDOCYSA-N |
| XLogP | 6.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|