C21H18N2O3 — CID 5369677
ethyl (Z,2Z)-3-amino-2-benzylidene-4-cyano-5-oxo-5-phenylpent-3-enoate (PubChem CID 5369677) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is ethyl (Z,2Z)-3-amino-2-benzylidene-4-cyano-5-oxo-5-phenylpent-3-enoate.
| Compound Name | ethyl (Z,2Z)-3-amino-2-benzylidene-4-cyano-5-oxo-5-phenylpent-3-enoate |
|---|---|
| PubChem CID | 5369677 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | ethyl (Z,2Z)-3-amino-2-benzylidene-4-cyano-5-oxo-5-phenylpent-3-enoate |
| SMILES | CCOC(=O)C(=C\c1ccccc1)/C(N)=C(\C#N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O3/c1-2-26-21(25)17(13-15-9-5-3-6-10-15)19(23)18(14-22)20(24)16-11-7-4-8-12-16/h3-13H,2,23H2,1H3/b17-13-,19-18- |
| InChIKey | KZXQWMXWQYVOSF-PVAPHJRMSA-N |
| XLogP | 3.25 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|