C16H20O4 — CID 5371039
(3E,5E,11E,13E)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione (PubChem CID 5371039) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3E,5E,11E,13E)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione.
| Compound Name | (3E,5E,11E,13E)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
|---|---|
| PubChem CID | 5371039 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3E,5E,11E,13E)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
| SMILES | CC1C/C=C/C=C/C(=O)OC(C)C/C=C/C=C/C(=O)O1 |
| InChI | InChI=1S/C16H20O4/c1-13-9-5-3-7-12-16(18)20-14(2)10-6-4-8-11-15(17)19-13/h3-8,11-14H,9-10H2,1-2H3/b5-3+,6-4+,11-8+,12-7+ |
| InChIKey | XQBSQYZKUQYYAV-OTRXWVIUSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |