C17H23N3O3S — CID 5372117
methyl 2-[[(4-methoxyphenyl)-(piperidine-1-carbothioylamino)methylidene]amino]acetate (PubChem CID 5372117) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is methyl 2-[[(4-methoxyphenyl)-(piperidine-1-carbothioylamino)methylidene]amino]acetate.
| Compound Name | methyl 2-[[(4-methoxyphenyl)-(piperidine-1-carbothioylamino)methylidene]amino]acetate |
|---|---|
| PubChem CID | 5372117 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl 2-[[(4-methoxyphenyl)-(piperidine-1-carbothioylamino)methylidene]amino]acetate |
| SMILES | COC(=O)C/N=C(\NC(=S)N1CCCCC1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H23N3O3S/c1-22-14-8-6-13(7-9-14)16(18-12-15(21)23-2)19-17(24)20-10-4-3-5-11-20/h6-9H,3-5,10-12H2,1-2H3,(H,18,19,24) |
| InChIKey | IBDCHJFFORPPRD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|