C22H25N3O4S — CID 5368346
benzyl 2-[[(4-methoxyphenyl)-(morpholine-4-carbothioylamino)methylidene]amino]acetate (PubChem CID 5368346) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is benzyl 2-[[(4-methoxyphenyl)-(morpholine-4-carbothioylamino)methylidene]amino]acetate.
| Compound Name | benzyl 2-[[(4-methoxyphenyl)-(morpholine-4-carbothioylamino)methylidene]amino]acetate |
|---|---|
| PubChem CID | 5368346 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | benzyl 2-[[(4-methoxyphenyl)-(morpholine-4-carbothioylamino)methylidene]amino]acetate |
| SMILES | COc1ccc(/C(=N/CC(=O)OCc2ccccc2)NC(=S)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-27-19-9-7-18(8-10-19)21(24-22(30)25-11-13-28-14-12-25)23-15-20(26)29-16-17-5-3-2-4-6-17/h2-10H,11-16H2,1H3,(H,23,24,30) |
| InChIKey | GDMGRSJFTPNPSK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|