C25H28N4O7 — CID 86753757
methyl 2-[2,3-dioxo-4-[3-[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenoxy]propyl]piperazin-1-yl]acetate (PubChem CID 86753757) has the molecular formula C25H28N4O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is methyl 2-[2,3-dioxo-4-[3-[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenoxy]propyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-[2,3-dioxo-4-[3-[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenoxy]propyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 86753757 |
| Molecular Formula | C25H28N4O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | methyl 2-[2,3-dioxo-4-[3-[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenoxy]propyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(CCCOc2ccc(C(N)=NC(=O)OCc3ccccc3)cc2)C(=O)C1=O |
| InChI | InChI=1S/C25H28N4O7/c1-34-21(30)16-29-14-13-28(23(31)24(29)32)12-5-15-35-20-10-8-19(9-11-20)22(26)27-25(33)36-17-18-6-3-2-4-7-18/h2-4,6-11H,5,12-17H2,1H3,(H2,26,27,33) |
| InChIKey | IBULUNHRVKHGBB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|