C15H24O2 — CID 5372326
(E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enoic acid (PubChem CID 5372326) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enoic acid.
| Compound Name | (E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enoic acid |
|---|---|
| PubChem CID | 5372326 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enoic acid |
| SMILES | CC1=C(CC/C(C)=C/C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C15H24O2/c1-11(10-14(16)17)7-8-13-12(2)6-5-9-15(13,3)4/h10H,5-9H2,1-4H3,(H,16,17)/b11-10+ |
| InChIKey | SFGDHIDRBMMCCU-ZHACJKMWSA-N |
| XLogP | 4.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|