C28H42O8 — CID 537383
(17-acetyl-11-acetyloxy-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-yl) 2-hydroxy-3-methylbutanoate (PubChem CID 537383) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is (17-acetyl-11-acetyloxy-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-yl) 2-hydroxy-3-methylbutanoate.
| Compound Name | (17-acetyl-11-acetyloxy-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-yl) 2-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 537383 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (17-acetyl-11-acetyloxy-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-yl) 2-hydroxy-3-methylbutanoate |
| SMILES | CC(=O)OC1C2C(CC=C3CC(O)CCC32C)C2(O)CCC(C(C)=O)C2(C)C1OC(=O)C(O)C(C)C |
| InChI | InChI=1S/C28H42O8/c1-14(2)22(32)25(33)36-24-23(35-16(4)30)21-20(8-7-17-13-18(31)9-11-26(17,21)5)28(34)12-10-19(15(3)29)27(24,28)6/h7,14,18-24,31-32,34H,8-13H2,1-6H3 |
| InChIKey | LNIFOMHODGLYPH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|