C12H16O3 — CID 5373911
(3Z,6Z)-3,4,5,6,7-pentamethyl-5H-oxocine-2,8-dione (PubChem CID 5373911) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3Z,6Z)-3,4,5,6,7-pentamethyl-5H-oxocine-2,8-dione.
| Compound Name | (3Z,6Z)-3,4,5,6,7-pentamethyl-5H-oxocine-2,8-dione |
|---|---|
| PubChem CID | 5373911 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3Z,6Z)-3,4,5,6,7-pentamethyl-5H-oxocine-2,8-dione |
| SMILES | C/C1=C(\C)C(C)/C(C)=C(/C)C(=O)OC1=O |
| InChI | InChI=1S/C12H16O3/c1-6-7(2)9(4)11(13)15-12(14)10(5)8(6)3/h6H,1-5H3/b9-7-,10-8- |
| InChIKey | SVACDQQOFIQHNE-XOHWUJONSA-N |
| XLogP | 2.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|