C10H14O2 — CID 5374054
4-methyl-5-[(1E,3E)-penta-1,3-dienyl]oxolan-2-one (PubChem CID 5374054) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-methyl-5-[(1E,3E)-penta-1,3-dienyl]oxolan-2-one.
| Compound Name | 4-methyl-5-[(1E,3E)-penta-1,3-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 5374054 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 4-methyl-5-[(1E,3E)-penta-1,3-dienyl]oxolan-2-one |
| SMILES | C/C=C/C=C/C1OC(=O)CC1C |
| InChI | InChI=1S/C10H14O2/c1-3-4-5-6-9-8(2)7-10(11)12-9/h3-6,8-9H,7H2,1-2H3/b4-3+,6-5+ |
| InChIKey | UILOTAMXXHSBOK-VNKDHWASSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|